About 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride
1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride (PubChem CID 157420030) has the molecular formula C21H28Cl3N3
and a molecular weight of 428.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride |
| PubChem CID | 157420030 |
| Molecular Formula | C21H28Cl3N3 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride |
| SMILES | Cl.Clc1ccccc1N1CCCCC1.Clc1ccccc1N1CCNCC1 |
| InChI | InChI=1S/C11H14ClN.C10H13ClN2.ClH/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13;11-9-3-1-2-4-10(9)13-7-5-12-6-8-13;/h2-3,6-7H,1,4-5,8-9H2;1-4,12H,5-8H2;1H |
| InChIKey | WEJCOFGMNDOXIG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride?
The IUPAC name of 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride (CID 157420030) is 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride.
What is the SMILES notation for 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride?
The canonical SMILES for 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride is Cl.Clc1ccccc1N1CCCCC1.Clc1ccccc1N1CCNCC1.
What is the InChIKey of 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride?
The InChIKey is WEJCOFGMNDOXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN.C10H13ClN2.ClH/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13;11-9-3-1-2-4-10(9)13-7-5-12-6-8-13;/h2-3,6-7H,1,4-5,8-9H2;1-4,12H,5-8H2;1H.
What are the key properties of 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride?
1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride has a molecular weight of 428.84 g/mol, XLogP of 5.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)piperazine;1-(2-chlorophenyl)piperidine;hydrochloride is sourced from PubChem (CID 157420030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).