About 1-(2-bromo-3-chlorophenyl)-1,4-diazepane
1-(2-bromo-3-chlorophenyl)-1,4-diazepane (PubChem CID 103481679) has the molecular formula C11H14BrClN2
and a molecular weight of 289.60 g/mol. Its IUPAC name is 1-(2-bromo-3-chlorophenyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(2-bromo-3-chlorophenyl)-1,4-diazepane |
| PubChem CID | 103481679 |
| Molecular Formula | C11H14BrClN2 |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 1-(2-bromo-3-chlorophenyl)-1,4-diazepane |
| SMILES | Clc1cccc(N2CCCNCC2)c1Br |
| InChI | InChI=1S/C11H14BrClN2/c12-11-9(13)3-1-4-10(11)15-7-2-5-14-6-8-15/h1,3-4,14H,2,5-8H2 |
| InChIKey | FQNKHOWCMYBGHE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-bromo-3-chlorophenyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-3-chlorophenyl)-1,4-diazepane?
The IUPAC name of 1-(2-bromo-3-chlorophenyl)-1,4-diazepane (CID 103481679) is 1-(2-bromo-3-chlorophenyl)-1,4-diazepane.
What is the SMILES notation for 1-(2-bromo-3-chlorophenyl)-1,4-diazepane?
The canonical SMILES for 1-(2-bromo-3-chlorophenyl)-1,4-diazepane is Clc1cccc(N2CCCNCC2)c1Br.
What is the InChIKey of 1-(2-bromo-3-chlorophenyl)-1,4-diazepane?
The InChIKey is FQNKHOWCMYBGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrClN2/c12-11-9(13)3-1-4-10(11)15-7-2-5-14-6-8-15/h1,3-4,14H,2,5-8H2.
What are the key properties of 1-(2-bromo-3-chlorophenyl)-1,4-diazepane?
1-(2-bromo-3-chlorophenyl)-1,4-diazepane has a molecular weight of 289.60 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-3-chlorophenyl)-1,4-diazepane is sourced from PubChem (CID 103481679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).