C11H16N2O3S — CID 86209666
2-(1,4-diazepan-1-yl)benzenesulfonic acid (PubChem CID 86209666) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)benzenesulfonic acid.
| Compound Name | 2-(1,4-diazepan-1-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 86209666 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1N1CCCNCC1 |
| InChI | InChI=1S/C11H16N2O3S/c14-17(15,16)11-5-2-1-4-10(11)13-8-3-6-12-7-9-13/h1-2,4-5,12H,3,6-9H2,(H,14,15,16) |
| InChIKey | QYTONEIFMAZMNF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|