C10H13FN2O3S — CID 86209670
5-fluoro-2-piperazin-1-ylbenzenesulfonic acid (PubChem CID 86209670) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-fluoro-2-piperazin-1-ylbenzenesulfonic acid.
| Compound Name | 5-fluoro-2-piperazin-1-ylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86209670 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-fluoro-2-piperazin-1-ylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(F)ccc1N1CCNCC1 |
| InChI | InChI=1S/C10H13FN2O3S/c11-8-1-2-9(10(7-8)17(14,15)16)13-5-3-12-4-6-13/h1-2,7,12H,3-6H2,(H,14,15,16) |
| InChIKey | XCRMCTQKEAWUCS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|