C12H13F4NO2S2 — CID 133283409
4-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-1,4-thiazepane (PubChem CID 133283409) has the molecular formula C12H13F4NO2S2 and a molecular weight of 343.37 g/mol. Its IUPAC name is 4-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-1,4-thiazepane.
| Compound Name | 4-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 133283409 |
| Molecular Formula | C12H13F4NO2S2 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-1,4-thiazepane |
| SMILES | O=S(=O)(c1cc(F)ccc1N1CCCSCC1)C(F)(F)F |
| InChI | InChI=1S/C12H13F4NO2S2/c13-9-2-3-10(17-4-1-6-20-7-5-17)11(8-9)21(18,19)12(14,15)16/h2-3,8H,1,4-7H2 |
| InChIKey | PWZDJQPUACVMCN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |