C16H16F4N4O2S — CID 102563444
4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-3-yl]pyrimidin-2-amine (PubChem CID 102563444) has the molecular formula C16H16F4N4O2S and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 102563444 |
| Molecular Formula | C16H16F4N4O2S |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-3-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(C2CCCN(c3ccc(F)cc3S(=O)(=O)C(F)(F)F)C2)n1 |
| InChI | InChI=1S/C16H16F4N4O2S/c17-11-3-4-13(14(8-11)27(25,26)16(18,19)20)24-7-1-2-10(9-24)12-5-6-22-15(21)23-12/h3-6,8,10H,1-2,7,9H2,(H2,21,22,23) |
| InChIKey | KNFXOZBDXGLDKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |