C15H15F4N3O2S — CID 133284456
1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-4-pyrazol-1-ylpiperidine (PubChem CID 133284456) has the molecular formula C15H15F4N3O2S and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-4-pyrazol-1-ylpiperidine.
| Compound Name | 1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-4-pyrazol-1-ylpiperidine |
|---|---|
| PubChem CID | 133284456 |
| Molecular Formula | C15H15F4N3O2S |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-4-pyrazol-1-ylpiperidine |
| SMILES | O=S(=O)(c1cc(F)ccc1N1CCC(n2cccn2)CC1)C(F)(F)F |
| InChI | InChI=1S/C15H15F4N3O2S/c16-11-2-3-13(14(10-11)25(23,24)15(17,18)19)21-8-4-12(5-9-21)22-7-1-6-20-22/h1-3,6-7,10,12H,4-5,8-9H2 |
| InChIKey | GXJNSFLLPYBRDW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |