C15H18F4N2O3S — CID 133284294
N-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-4-yl]-N-methylacetamide (PubChem CID 133284294) has the molecular formula C15H18F4N2O3S and a molecular weight of 382.38 g/mol. Its IUPAC name is N-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 133284294 |
| Molecular Formula | C15H18F4N2O3S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]piperidin-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C1CCN(c2ccc(F)cc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18F4N2O3S/c1-10(22)20(2)12-5-7-21(8-6-12)13-4-3-11(16)9-14(13)25(23,24)15(17,18)19/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | CXULAPSMGUWLBX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |