C14H18F4N2O2S — CID 133284902
4-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-2-(trifluoromethylsulfonyl)aniline (PubChem CID 133284902) has the molecular formula C14H18F4N2O2S and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | 4-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133284902 |
| Molecular Formula | C14H18F4N2O2S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CN1CCC(CNc2ccc(F)cc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F4N2O2S/c1-20-6-4-10(5-7-20)9-19-12-3-2-11(15)8-13(12)23(21,22)14(16,17)18/h2-3,8,10,19H,4-7,9H2,1H3 |
| InChIKey | KHMCVPNQZUFLLU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |