C15H19F4N3O3S — CID 133283161
1-[4-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]piperazin-1-yl]ethanone (PubChem CID 133283161) has the molecular formula C15H19F4N3O3S and a molecular weight of 397.39 g/mol. Its IUPAC name is 1-[4-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 133283161 |
| Molecular Formula | C15H19F4N3O3S |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-[4-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CCNc2ccc(F)cc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H19F4N3O3S/c1-11(23)22-8-6-21(7-9-22)5-4-20-13-3-2-12(16)10-14(13)26(24,25)15(17,18)19/h2-3,10,20H,4-9H2,1H3 |
| InChIKey | XHGLONNAYVUWJY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |