C13H13F4N3O2S — CID 133283529
4-fluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline (PubChem CID 133283529) has the molecular formula C13H13F4N3O2S and a molecular weight of 351.33 g/mol. Its IUPAC name is 4-fluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | 4-fluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133283529 |
| Molecular Formula | C13H13F4N3O2S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-fluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]-2-(trifluoromethylsulfonyl)aniline |
| SMILES | Cn1cc(CCNc2ccc(F)cc2S(=O)(=O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H13F4N3O2S/c1-20-8-9(7-19-20)4-5-18-11-3-2-10(14)6-12(11)23(21,22)13(15,16)17/h2-3,6-8,18H,4-5H2,1H3 |
| InChIKey | QSNCVOYNNOUXOA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |