C12H16F4N2O2S — CID 62893183
N-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]propane-1,3-diamine (PubChem CID 62893183) has the molecular formula C12H16F4N2O2S and a molecular weight of 328.33 g/mol. Its IUPAC name is N-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 62893183 |
| Molecular Formula | C12H16F4N2O2S |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-ethyl-N'-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]propane-1,3-diamine |
| SMILES | CCNCCCNc1ccc(F)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H16F4N2O2S/c1-2-17-6-3-7-18-10-5-4-9(13)8-11(10)21(19,20)12(14,15)16/h4-5,8,17-18H,2-3,6-7H2,1H3 |
| InChIKey | JGNLCSMVGHTLLO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|