C10H9F4NO2S — CID 62866721
4-fluoro-N-prop-2-enyl-2-(trifluoromethylsulfonyl)aniline (PubChem CID 62866721) has the molecular formula C10H9F4NO2S and a molecular weight of 283.25 g/mol. Its IUPAC name is 4-fluoro-N-prop-2-enyl-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | 4-fluoro-N-prop-2-enyl-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 62866721 |
| Molecular Formula | C10H9F4NO2S |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-fluoro-N-prop-2-enyl-2-(trifluoromethylsulfonyl)aniline |
| SMILES | C=CCNc1ccc(F)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F4NO2S/c1-2-5-15-8-4-3-7(11)6-9(8)18(16,17)10(12,13)14/h2-4,6,15H,1,5H2 |
| InChIKey | KUSKEZNOGCZCOJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|