C12H14FN — CID 45141264
4-fluoro-N,2-bis(prop-2-enyl)aniline (PubChem CID 45141264) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 4-fluoro-N,2-bis(prop-2-enyl)aniline.
| Compound Name | 4-fluoro-N,2-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 45141264 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-fluoro-N,2-bis(prop-2-enyl)aniline |
| SMILES | C=CCNc1ccc(F)cc1CC=C |
| InChI | InChI=1S/C12H14FN/c1-3-5-10-9-11(13)6-7-12(10)14-8-4-2/h3-4,6-7,9,14H,1-2,5,8H2 |
| InChIKey | VMRPIFRCONYQED-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|