C11H15N — CID 11768869
2,4-dimethyl-N-prop-2-enylaniline (PubChem CID 11768869) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 2,4-dimethyl-N-prop-2-enylaniline.
| Compound Name | 2,4-dimethyl-N-prop-2-enylaniline |
|---|---|
| PubChem CID | 11768869 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2,4-dimethyl-N-prop-2-enylaniline |
| SMILES | C=CCNc1ccc(C)cc1C |
| InChI | InChI=1S/C11H15N/c1-4-7-12-11-6-5-9(2)8-10(11)3/h4-6,8,12H,1,7H2,2-3H3 |
| InChIKey | GWKSNWNYTKMCBB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|