C16H28N2 — CID 54806040
N-(2,4-dimethylphenyl)-N',N'-dipropylethane-1,2-diamine (PubChem CID 54806040) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N',N'-dipropylethane-1,2-diamine.
| Compound Name | N-(2,4-dimethylphenyl)-N',N'-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 54806040 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N',N'-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)CCNc1ccc(C)cc1C |
| InChI | InChI=1S/C16H28N2/c1-5-10-18(11-6-2)12-9-17-16-8-7-14(3)13-15(16)4/h7-8,13,17H,5-6,9-12H2,1-4H3 |
| InChIKey | QFSKEDDGTRUZAK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |