C12H20N2O2 — CID 155599638
3-[2-(dipropylamino)ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 155599638) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-[2-(dipropylamino)ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[2-(dipropylamino)ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155599638 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-[2-(dipropylamino)ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CCCN(CCC)CCNc1cc(=O)c1=O |
| InChI | InChI=1S/C12H20N2O2/c1-3-6-14(7-4-2)8-5-13-10-9-11(15)12(10)16/h9,13H,3-8H2,1-2H3 |
| InChIKey | HRAGVNLHOSYZCI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|