C14H32Cl2CuN2 — CID 173220390
copper;N,N,N',N'-tetrapropylethane-1,2-diamine;dichloride (PubChem CID 173220390) has the molecular formula C14H32Cl2CuN2 and a molecular weight of 362.88 g/mol. Its IUPAC name is copper;N,N,N',N'-tetrapropylethane-1,2-diamine;dichloride.
| Compound Name | copper;N,N,N',N'-tetrapropylethane-1,2-diamine;dichloride |
|---|---|
| PubChem CID | 173220390 |
| Molecular Formula | C14H32Cl2CuN2 |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | copper;N,N,N',N'-tetrapropylethane-1,2-diamine;dichloride |
| SMILES | CCCN(CCC)CCN(CCC)CCC.[Cl-].[Cl-].[Cu+2] |
| InChI | InChI=1S/C14H32N2.2ClH.Cu/c1-5-9-15(10-6-2)13-14-16(11-7-3)12-8-4;;;/h5-14H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | JGFRCZUIFWIBEE-UHFFFAOYSA-L |
| XLogP | -2.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |