C16H32CuF6N2O6S2 — CID 173220495
copper;N,N,N',N'-tetrapropylethane-1,2-diamine;bis(trifluoromethanesulfonate) (PubChem CID 173220495) has the molecular formula C16H32CuF6N2O6S2 and a molecular weight of 590.11 g/mol. Its IUPAC name is copper;N,N,N',N'-tetrapropylethane-1,2-diamine;bis(trifluoromethanesulfonate).
| Compound Name | copper;N,N,N',N'-tetrapropylethane-1,2-diamine;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 173220495 |
| Molecular Formula | C16H32CuF6N2O6S2 |
| Molecular Weight | 590.11 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | copper;N,N,N',N'-tetrapropylethane-1,2-diamine;bis(trifluoromethanesulfonate) |
| SMILES | CCCN(CCC)CCN(CCC)CCC.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Cu+2] |
| InChI | InChI=1S/C14H32N2.2CHF3O3S.Cu/c1-5-9-15(10-6-2)13-14-16(11-7-3)12-8-4;2*2-1(3,4)8(5,6)7;/h5-14H2,1-4H3;2*(H,5,6,7);/q;;;+2/p-2 |
| InChIKey | HRXUVXYUBGYWFM-UHFFFAOYSA-L |
| XLogP | 3.33 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|