About triethylphosphanium;trifluoromethanesulfonate
triethylphosphanium;trifluoromethanesulfonate (PubChem CID 158854651) has the molecular formula C7H16F3O3PS
and a molecular weight of 268.24 g/mol. Its IUPAC name is triethylphosphanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | triethylphosphanium;trifluoromethanesulfonate |
| PubChem CID | 158854651 |
| Molecular Formula | C7H16F3O3PS |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | triethylphosphanium;trifluoromethanesulfonate |
| SMILES | CC[PH+](CC)CC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C6H15P.CHF3O3S/c1-4-7(5-2)6-3;2-1(3,4)8(5,6)7/h4-6H2,1-3H3;(H,5,6,7) |
| InChIKey | IZWVRRUPWWPJIT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze triethylphosphanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylphosphanium;trifluoromethanesulfonate?
The IUPAC name of triethylphosphanium;trifluoromethanesulfonate (CID 158854651) is triethylphosphanium;trifluoromethanesulfonate.
What is the SMILES notation for triethylphosphanium;trifluoromethanesulfonate?
The canonical SMILES for triethylphosphanium;trifluoromethanesulfonate is CC[PH+](CC)CC.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of triethylphosphanium;trifluoromethanesulfonate?
The InChIKey is IZWVRRUPWWPJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P.CHF3O3S/c1-4-7(5-2)6-3;2-1(3,4)8(5,6)7/h4-6H2,1-3H3;(H,5,6,7).
What are the key properties of triethylphosphanium;trifluoromethanesulfonate?
triethylphosphanium;trifluoromethanesulfonate has a molecular weight of 268.24 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethylphosphanium;trifluoromethanesulfonate is sourced from PubChem (CID 158854651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).