About dimethylalumanylium;trifluoromethanesulfonate
dimethylalumanylium;trifluoromethanesulfonate (PubChem CID 16688558) has the molecular formula C3H6AlF3O3S
and a molecular weight of 206.12 g/mol. Its IUPAC name is dimethylalumanylium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | dimethylalumanylium;trifluoromethanesulfonate |
| PubChem CID | 16688558 |
| Molecular Formula | C3H6AlF3O3S |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 205.98 |
| IUPAC Name | dimethylalumanylium;trifluoromethanesulfonate |
| SMILES | C[Al+]C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/CHF3O3S.2CH3.Al/c2-1(3,4)8(5,6)7;;;/h(H,5,6,7);2*1H3;/q;;;+1/p-1 |
| InChIKey | JFCUDJNPMXFAMD-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze dimethylalumanylium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylalumanylium;trifluoromethanesulfonate?
The IUPAC name of dimethylalumanylium;trifluoromethanesulfonate (CID 16688558) is dimethylalumanylium;trifluoromethanesulfonate.
What is the SMILES notation for dimethylalumanylium;trifluoromethanesulfonate?
The canonical SMILES for dimethylalumanylium;trifluoromethanesulfonate is C[Al+]C.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of dimethylalumanylium;trifluoromethanesulfonate?
The InChIKey is JFCUDJNPMXFAMD-UHFFFAOYSA-M. The full InChI is InChI=1S/CHF3O3S.2CH3.Al/c2-1(3,4)8(5,6)7;;;/h(H,5,6,7);2*1H3;/q;;;+1/p-1.
What are the key properties of dimethylalumanylium;trifluoromethanesulfonate?
dimethylalumanylium;trifluoromethanesulfonate has a molecular weight of 206.12 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylalumanylium;trifluoromethanesulfonate is sourced from PubChem (CID 16688558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).