About lanthanum(3+);trifluoromethanesulfonate;hydrate
lanthanum(3+);trifluoromethanesulfonate;hydrate (PubChem CID 22625223) has the molecular formula CH2F3LaO4S+2
and a molecular weight of 305.99 g/mol. Its IUPAC name is lanthanum(3+);trifluoromethanesulfonate;hydrate.
Molecular Properties
| Compound Name | lanthanum(3+);trifluoromethanesulfonate;hydrate |
| PubChem CID | 22625223 |
| Molecular Formula | CH2F3LaO4S+2 |
| Molecular Weight | 305.99 g/mol |
| Exact Mass | 305.87 |
| IUPAC Name | lanthanum(3+);trifluoromethanesulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])C(F)(F)F.[La+3] |
| InChI | InChI=1S/CHF3O3S.La.H2O/c2-1(3,4)8(5,6)7;;/h(H,5,6,7);;1H2/q;+3;/p-1 |
| InChIKey | QGPAKQJOBUXLPY-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.99 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze lanthanum(3+);trifluoromethanesulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum(3+);trifluoromethanesulfonate;hydrate?
The IUPAC name of lanthanum(3+);trifluoromethanesulfonate;hydrate (CID 22625223) is lanthanum(3+);trifluoromethanesulfonate;hydrate.
What is the SMILES notation for lanthanum(3+);trifluoromethanesulfonate;hydrate?
The canonical SMILES for lanthanum(3+);trifluoromethanesulfonate;hydrate is O.O=S(=O)([O-])C(F)(F)F.[La+3].
What is the InChIKey of lanthanum(3+);trifluoromethanesulfonate;hydrate?
The InChIKey is QGPAKQJOBUXLPY-UHFFFAOYSA-M. The full InChI is InChI=1S/CHF3O3S.La.H2O/c2-1(3,4)8(5,6)7;;/h(H,5,6,7);;1H2/q;+3;/p-1.
What are the key properties of lanthanum(3+);trifluoromethanesulfonate;hydrate?
lanthanum(3+);trifluoromethanesulfonate;hydrate has a molecular weight of 305.99 g/mol, XLogP of -0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum(3+);trifluoromethanesulfonate;hydrate is sourced from PubChem (CID 22625223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).