About ethylazanyliumylethane; trifluoromethanesulfonate
ethylazanyliumylethane; trifluoromethanesulfonate (PubChem CID 53431550) has the molecular formula C5H10F3NO3S
and a molecular weight of 221.20 g/mol.
Molecular Properties
| Compound Name | ethylazanyliumylethane; trifluoromethanesulfonate |
| PubChem CID | 53431550 |
| Molecular Formula | C5H10F3NO3S |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | — |
| SMILES | CC[N+]CC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C4H10N.CHF3O3S/c1-3-5-4-2;2-1(3,4)8(5,6)7/h3-4H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | DXXBJTJUHFSJFX-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 71.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethylazanyliumylethane; trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylazanyliumylethane; trifluoromethanesulfonate?
The IUPAC name of ethylazanyliumylethane; trifluoromethanesulfonate (CID 53431550) is not available.
What is the SMILES notation for ethylazanyliumylethane; trifluoromethanesulfonate?
The canonical SMILES for ethylazanyliumylethane; trifluoromethanesulfonate is CC[N+]CC.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of ethylazanyliumylethane; trifluoromethanesulfonate?
The InChIKey is DXXBJTJUHFSJFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10N.CHF3O3S/c1-3-5-4-2;2-1(3,4)8(5,6)7/h3-4H2,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of ethylazanyliumylethane; trifluoromethanesulfonate?
ethylazanyliumylethane; trifluoromethanesulfonate has a molecular weight of 221.20 g/mol, XLogP of 0.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylazanyliumylethane; trifluoromethanesulfonate is sourced from PubChem (CID 53431550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).