C12H30ClNO — CID 173448711
N,N-dipropylpropan-1-amine;propan-1-ol;hydrochloride (PubChem CID 173448711) has the molecular formula C12H30ClNO and a molecular weight of 239.83 g/mol. Its IUPAC name is N,N-dipropylpropan-1-amine;propan-1-ol;hydrochloride.
| Compound Name | N,N-dipropylpropan-1-amine;propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 173448711 |
| Molecular Formula | C12H30ClNO |
| Molecular Weight | 239.83 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N,N-dipropylpropan-1-amine;propan-1-ol;hydrochloride |
| SMILES | CCCN(CCC)CCC.CCCO.Cl |
| InChI | InChI=1S/C9H21N.C3H8O.ClH/c1-4-7-10(8-5-2)9-6-3;1-2-3-4;/h4-9H2,1-3H3;4H,2-3H2,1H3;1H |
| InChIKey | YEXIEGIAHHEYRI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |