About 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride
2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride (PubChem CID 174894072) has the molecular formula C7H21Cl2NO2
and a molecular weight of 222.16 g/mol. Its IUPAC name is 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride |
| PubChem CID | 174894072 |
| Molecular Formula | C7H21Cl2NO2 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride |
| SMILES | CCCN(CC)CCO.Cl.Cl.O |
| InChI | InChI=1S/C7H17NO.2ClH.H2O/c1-3-5-8(4-2)6-7-9;;;/h9H,3-7H2,1-2H3;2*1H;1H2 |
| InChIKey | JNTZAPZWJVRLSO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride?
The IUPAC name of 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride (CID 174894072) is 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride.
What is the SMILES notation for 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride?
The canonical SMILES for 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride is CCCN(CC)CCO.Cl.Cl.O.
What is the InChIKey of 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride?
The InChIKey is JNTZAPZWJVRLSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO.2ClH.H2O/c1-3-5-8(4-2)6-7-9;;;/h9H,3-7H2,1-2H3;2*1H;1H2.
What are the key properties of 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride?
2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride has a molecular weight of 222.16 g/mol, XLogP of 0.73, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(propyl)amino]ethanol;hydrate;dihydrochloride is sourced from PubChem (CID 174894072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).