C6H18NO6P — CID 19082538
2-[ethyl(2-hydroxyethyl)amino]ethanol;phosphoric acid (PubChem CID 19082538) has the molecular formula C6H18NO6P and a molecular weight of 231.18 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]ethanol;phosphoric acid.
| Compound Name | 2-[ethyl(2-hydroxyethyl)amino]ethanol;phosphoric acid |
|---|---|
| PubChem CID | 19082538 |
| Molecular Formula | C6H18NO6P |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[ethyl(2-hydroxyethyl)amino]ethanol;phosphoric acid |
| SMILES | CCN(CCO)CCO.O=P(O)(O)O |
| InChI | InChI=1S/C6H15NO2.H3O4P/c1-2-7(3-5-8)4-6-9;1-5(2,3)4/h8-9H,2-6H2,1H3;(H3,1,2,3,4) |
| InChIKey | LUWVKYMYFUDIPU-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|