About 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid
2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid (PubChem CID 160646043) has the molecular formula C7H20NO6P
and a molecular weight of 245.21 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid |
| PubChem CID | 160646043 |
| Molecular Formula | C7H20NO6P |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid |
| SMILES | CP(=O)(O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.CH5O3P/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;1H3,(H2,2,3,4) |
| InChIKey | RJUJRIRWCJCIFD-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid (CID 160646043) is 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid is CP(=O)(O)O.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid?
The InChIKey is RJUJRIRWCJCIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.CH5O3P/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;1H3,(H2,2,3,4).
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid?
2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid has a molecular weight of 245.21 g/mol, XLogP of -1.94, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;methylphosphonic acid is sourced from PubChem (CID 160646043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).