About 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt
2-[bis(2-hydroxyethyl)amino]ethanol;cobalt (PubChem CID 161104033) has the molecular formula C6H15CoNO3
and a molecular weight of 208.12 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt |
| PubChem CID | 161104033 |
| Molecular Formula | C6H15CoNO3 |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt |
| SMILES | OCCN(CCO)CCO.[Co] |
| InChI | InChI=1S/C6H15NO3.Co/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2; |
| InChIKey | UIUSXTVZPVPHOU-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt (CID 161104033) is 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt is OCCN(CCO)CCO.[Co].
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt?
The InChIKey is UIUSXTVZPVPHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.Co/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt?
2-[bis(2-hydroxyethyl)amino]ethanol;cobalt has a molecular weight of 208.12 g/mol, XLogP of -1.74, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;cobalt is sourced from PubChem (CID 161104033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).