About 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+)
2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) (PubChem CID 159992570) has the molecular formula C6H15NNiO3+2
and a molecular weight of 207.88 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+).
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) |
| PubChem CID | 159992570 |
| Molecular Formula | C6H15NNiO3+2 |
| Molecular Weight | 207.88 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) |
| SMILES | OCCN(CCO)CCO.[Ni+2] |
| InChI | InChI=1S/C6H15NO3.Ni/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;/q;+2 |
| InChIKey | OHDCVPRZVIOVOK-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.88 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+)?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) (CID 159992570) is 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+).
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+)?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) is OCCN(CCO)CCO.[Ni+2].
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+)?
The InChIKey is OHDCVPRZVIOVOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.Ni/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;/q;+2.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+)?
2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) has a molecular weight of 207.88 g/mol, XLogP of -1.74, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;nickel(2+) is sourced from PubChem (CID 159992570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).