About 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate
2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate (PubChem CID 88718210) has the molecular formula C6H17CuNO4
and a molecular weight of 230.75 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate |
| PubChem CID | 88718210 |
| Molecular Formula | C6H17CuNO4 |
| Molecular Weight | 230.75 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate |
| SMILES | O.OCCN(CCO)CCO.[Cu] |
| InChI | InChI=1S/C6H15NO3.Cu.H2O/c8-4-1-7(2-5-9)3-6-10;;/h8-10H,1-6H2;;1H2 |
| InChIKey | LDPRMCUISARLSL-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.75 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate (CID 88718210) is 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate is O.OCCN(CCO)CCO.[Cu].
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate?
The InChIKey is LDPRMCUISARLSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.Cu.H2O/c8-4-1-7(2-5-9)3-6-10;;/h8-10H,1-6H2;;1H2.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate?
2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate has a molecular weight of 230.75 g/mol, XLogP of -2.56, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;copper;hydrate is sourced from PubChem (CID 88718210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).