copper 2-[bis(2-hydroxyethyl)amino]ethanol

C6H15CuNO3+2 — CID 18952570

IUPACcopper 2-[bis(2-hydroxyethyl)amino]ethanol
SMILESOCCN(CCO)CCO.[Cu+2]
InChIInChI=1S/C6H15NO3.Cu/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;/q;+2
InChIKeyCDJLVIMPMRGBIC-UHFFFAOYSA-N
MW212.74 g/mol
LogP-1.74
Rot. Bonds6

About copper 2-[bis(2-hydroxyethyl)amino]ethanol

copper 2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 18952570) has the molecular formula C6H15CuNO3+2 and a molecular weight of 212.74 g/mol. Its IUPAC name is copper 2-[bis(2-hydroxyethyl)amino]ethanol.

Molecular Properties

Compound Namecopper 2-[bis(2-hydroxyethyl)amino]ethanol
PubChem CID18952570
Molecular FormulaC6H15CuNO3+2
Molecular Weight212.74 g/mol
Exact Mass212.03
IUPAC Namecopper 2-[bis(2-hydroxyethyl)amino]ethanol
SMILESOCCN(CCO)CCO.[Cu+2]
InChIInChI=1S/C6H15NO3.Cu/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;/q;+2
InChIKeyCDJLVIMPMRGBIC-UHFFFAOYSA-N
XLogP-1.74
TPSA63.93 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.74
LogP ≤ 5-1.74
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze copper 2-[bis(2-hydroxyethyl)amino]ethanol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of copper 2-[bis(2-hydroxyethyl)amino]ethanol?
The IUPAC name of copper 2-[bis(2-hydroxyethyl)amino]ethanol (CID 18952570) is copper 2-[bis(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for copper 2-[bis(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for copper 2-[bis(2-hydroxyethyl)amino]ethanol is OCCN(CCO)CCO.[Cu+2].
What is the InChIKey of copper 2-[bis(2-hydroxyethyl)amino]ethanol?
The InChIKey is CDJLVIMPMRGBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.Cu/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;/q;+2.
What are the key properties of copper 2-[bis(2-hydroxyethyl)amino]ethanol?
copper 2-[bis(2-hydroxyethyl)amino]ethanol has a molecular weight of 212.74 g/mol, XLogP of -1.74, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper 2-[bis(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 18952570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).