About 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+)
2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) (PubChem CID 159674696) has the molecular formula C6H15NO3TiZr+8
and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+).
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) |
| PubChem CID | 159674696 |
| Molecular Formula | C6H15NO3TiZr+8 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 286.95 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) |
| SMILES | OCCN(CCO)CCO.[Ti+4].[Zr+4] |
| InChI | InChI=1S/C6H15NO3.Ti.Zr/c8-4-1-7(2-5-9)3-6-10;;/h8-10H,1-6H2;;/q;2*+4 |
| InChIKey | MULHCCSQHQGFQQ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+)?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) (CID 159674696) is 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+).
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+)?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) is OCCN(CCO)CCO.[Ti+4].[Zr+4].
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+)?
The InChIKey is MULHCCSQHQGFQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.Ti.Zr/c8-4-1-7(2-5-9)3-6-10;;/h8-10H,1-6H2;;/q;2*+4.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+)?
2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) has a molecular weight of 288.28 g/mol, XLogP of -1.74, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;titanium(4+);zirconium(4+) is sourced from PubChem (CID 159674696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).