About sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride
sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride (PubChem CID 23700456) has the molecular formula C6H15ClNNaO3
and a molecular weight of 207.63 g/mol. Its IUPAC name is sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride.
Molecular Properties
| Compound Name | sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride |
| PubChem CID | 23700456 |
| Molecular Formula | C6H15ClNNaO3 |
| Molecular Weight | 207.63 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride |
| SMILES | OCCN(CCO)CCO.[Cl-].[Na+] |
| InChI | InChI=1S/C6H15NO3.ClH.Na/c8-4-1-7(2-5-9)3-6-10;;/h8-10H,1-6H2;1H;/q;;+1/p-1 |
| InChIKey | UEUYEWLWWIWPLC-UHFFFAOYSA-M |
| XLogP | -7.73 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.63 |
| LogP ≤ 5 | -7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride?
The IUPAC name of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride (CID 23700456) is sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride.
What is the SMILES notation for sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride?
The canonical SMILES for sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride is OCCN(CCO)CCO.[Cl-].[Na+].
What is the InChIKey of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride?
The InChIKey is UEUYEWLWWIWPLC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15NO3.ClH.Na/c8-4-1-7(2-5-9)3-6-10;;/h8-10H,1-6H2;1H;/q;;+1/p-1.
What are the key properties of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride?
sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride has a molecular weight of 207.63 g/mol, XLogP of -7.73, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[bis(2-hydroxyethyl)amino]ethanol;chloride is sourced from PubChem (CID 23700456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).