About 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane
2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane (PubChem CID 158265405) has the molecular formula C7H17Cl2NO3
and a molecular weight of 234.12 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane |
| PubChem CID | 158265405 |
| Molecular Formula | C7H17Cl2NO3 |
| Molecular Weight | 234.12 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane |
| SMILES | ClCCl.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.CH2Cl2/c8-4-1-7(2-5-9)3-6-10;2-1-3/h8-10H,1-6H2;1H2 |
| InChIKey | GIJKBMOPKGGCLD-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.12 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane (CID 158265405) is 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane is ClCCl.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane?
The InChIKey is GIJKBMOPKGGCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.CH2Cl2/c8-4-1-7(2-5-9)3-6-10;2-1-3/h8-10H,1-6H2;1H2.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane?
2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane has a molecular weight of 234.12 g/mol, XLogP of -0.31, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;dichloromethane is sourced from PubChem (CID 158265405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).