About 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride
2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride (PubChem CID 159922681) has the molecular formula C7H21ClN2O3
and a molecular weight of 216.71 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride |
| PubChem CID | 159922681 |
| Molecular Formula | C7H21ClN2O3 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride |
| SMILES | C[NH3+].OCCN(CCO)CCO.[Cl-] |
| InChI | InChI=1S/C6H15NO3.CH5N.ClH/c8-4-1-7(2-5-9)3-6-10;1-2;/h8-10H,1-6H2;2H2,1H3;1H |
| InChIKey | NYPMOPCOFUOKOS-UHFFFAOYSA-N |
| XLogP | -5.87 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | -5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride (CID 159922681) is 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride is C[NH3+].OCCN(CCO)CCO.[Cl-].
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride?
The InChIKey is NYPMOPCOFUOKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.CH5N.ClH/c8-4-1-7(2-5-9)3-6-10;1-2;/h8-10H,1-6H2;2H2,1H3;1H.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride?
2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride has a molecular weight of 216.71 g/mol, XLogP of -5.87, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;methylazanium;chloride is sourced from PubChem (CID 159922681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).