About 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine
2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine (PubChem CID 160554975) has the molecular formula C8H22N2O3
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine |
| PubChem CID | 160554975 |
| Molecular Formula | C8H22N2O3 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.16 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine |
| SMILES | CCN.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C2H7N/c8-4-1-7(2-5-9)3-6-10;1-2-3/h8-10H,1-6H2;2-3H2,1H3 |
| InChIKey | QYOFBDOUWNZHQM-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine (CID 160554975) is 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine is CCN.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine?
The InChIKey is QYOFBDOUWNZHQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C2H7N/c8-4-1-7(2-5-9)3-6-10;1-2-3/h8-10H,1-6H2;2-3H2,1H3.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine?
2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine has a molecular weight of 194.27 g/mol, XLogP of -1.77, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;ethanamine is sourced from PubChem (CID 160554975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).