C9H24N2O8P2 — CID 87658738
[3-[bis(2-hydroxyethyl)amino]propyl-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 87658738) has the molecular formula C9H24N2O8P2 and a molecular weight of 350.25 g/mol. Its IUPAC name is [3-[bis(2-hydroxyethyl)amino]propyl-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [3-[bis(2-hydroxyethyl)amino]propyl-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 87658738 |
| Molecular Formula | C9H24N2O8P2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [3-[bis(2-hydroxyethyl)amino]propyl-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CN(CCCN(CCO)CCO)CP(=O)(O)O |
| InChI | InChI=1S/C9H24N2O8P2/c12-6-4-10(5-7-13)2-1-3-11(8-20(14,15)16)9-21(17,18)19/h12-13H,1-9H2,(H2,14,15,16)(H2,17,18,19) |
| InChIKey | SYHPZFPATKOFCA-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|