C8H22N2O6P2 — CID 20776526
[4-(dimethylamino)butyl-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 20776526) has the molecular formula C8H22N2O6P2 and a molecular weight of 304.22 g/mol. Its IUPAC name is [4-(dimethylamino)butyl-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [4-(dimethylamino)butyl-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 20776526 |
| Molecular Formula | C8H22N2O6P2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [4-(dimethylamino)butyl-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CN(C)CCCCN(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H22N2O6P2/c1-9(2)5-3-4-6-10(7-17(11,12)13)8-18(14,15)16/h3-8H2,1-2H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | VBUHPRKVQQIPSJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|