C6H20GdN2O12P4 — CID 11758054
[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid;gadolinium-153 (PubChem CID 11758054) has the molecular formula C6H20GdN2O12P4 and a molecular weight of 589.05 g/mol. Its IUPAC name is [2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid;gadolinium-153.
| Compound Name | [2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid;gadolinium-153 |
|---|---|
| PubChem CID | 11758054 |
| Molecular Formula | C6H20GdN2O12P4 |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 588.92 |
| IUPAC Name | [2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid;gadolinium-153 |
| SMILES | O=P(O)(O)CN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O.[153Gd] |
| InChI | InChI=1S/C6H20N2O12P4.Gd/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20;/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20);/i;1-4 |
| InChIKey | MDACQFAMNMRKDW-JWFOFJTQSA-N |
| XLogP | -1.87 |
| TPSA | 236.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|