C15H44KN5O21P7+ — CID 119057732
potassium [bis[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid (PubChem CID 119057732) has the molecular formula C15H44KN5O21P7+ and a molecular weight of 886.45 g/mol. Its IUPAC name is potassium [bis[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid.
| Compound Name | potassium [bis[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 119057732 |
| Molecular Formula | C15H44KN5O21P7+ |
| Molecular Weight | 886.45 g/mol |
| Exact Mass | 886.03 |
| IUPAC Name | potassium [bis[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CN(CCN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O)CCN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O.[K+] |
| InChI | InChI=1S/C15H44N5O21P7.K/c21-42(22,23)9-16(1-3-17(10-43(24,25)26)5-7-19(12-45(30,31)32)13-46(33,34)35)2-4-18(11-44(27,28)29)6-8-20(14-47(36,37)38)15-48(39,40)41;/h1-15H2,(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)(H2,30,31,32)(H2,33,34,35)(H2,36,37,38)(H2,39,40,41);/q;+1 |
| InChIKey | TXXCNYSYABKODM-UHFFFAOYSA-N |
| XLogP | -6.55 |
| TPSA | 418.91 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.45 |
| LogP ≤ 5 | -6.55 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|