C18H52N6O24P8 — CID 131954736
[2-[bis[2-[bis(phosphonomethyl)amino]ethyl]amino]ethyl-[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid (PubChem CID 131954736) has the molecular formula C18H52N6O24P8 and a molecular weight of 984.42 g/mol. Its IUPAC name is [2-[bis[2-[bis(phosphonomethyl)amino]ethyl]amino]ethyl-[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid.
| Compound Name | [2-[bis[2-[bis(phosphonomethyl)amino]ethyl]amino]ethyl-[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 131954736 |
| Molecular Formula | C18H52N6O24P8 |
| Molecular Weight | 984.42 g/mol |
| Exact Mass | 984.09 |
| IUPAC Name | [2-[bis[2-[bis(phosphonomethyl)amino]ethyl]amino]ethyl-[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CN(CCN(CCN(CP(=O)(O)O)CP(=O)(O)O)CCN(CP(=O)(O)O)CP(=O)(O)O)CCN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C18H52N6O24P8/c25-49(26,27)11-20(5-6-21(12-50(28,29)30)7-10-24(17-55(43,44)45)18-56(46,47)48)4-1-19(2-8-22(13-51(31,32)33)14-52(34,35)36)3-9-23(15-53(37,38)39)16-54(40,41)42/h1-18H2,(H2,25,26,27)(H2,28,29,30)(H2,31,32,33)(H2,34,35,36)(H2,37,38,39)(H2,40,41,42)(H2,43,44,45)(H2,46,47,48) |
| InChIKey | BAWFQQNPHJWZIR-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 479.68 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.42 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|