C10H31N3O12P4 — CID 170845455
azane;[6-[bis(phosphonomethyl)amino]hexyl-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 170845455) has the molecular formula C10H31N3O12P4 and a molecular weight of 509.26 g/mol. Its IUPAC name is azane;[6-[bis(phosphonomethyl)amino]hexyl-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | azane;[6-[bis(phosphonomethyl)amino]hexyl-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 170845455 |
| Molecular Formula | C10H31N3O12P4 |
| Molecular Weight | 509.26 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | azane;[6-[bis(phosphonomethyl)amino]hexyl-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | N.O=P(O)(O)CN(CCCCCCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C10H28N2O12P4.H3N/c13-25(14,15)7-11(8-26(16,17)18)5-3-1-2-4-6-12(9-27(19,20)21)10-28(22,23)24;/h1-10H2,(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24);1H3 |
| InChIKey | OXOOJUWPGNMILO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 271.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|