C11H30N2O11P4 — CID 59414854
[6-[bis(phosphonomethyl)amino]hexyl-[[hydroxy(methyl)phosphoryl]methyl]amino]methylphosphonic acid (PubChem CID 59414854) has the molecular formula C11H30N2O11P4 and a molecular weight of 490.26 g/mol. Its IUPAC name is [6-[bis(phosphonomethyl)amino]hexyl-[[hydroxy(methyl)phosphoryl]methyl]amino]methylphosphonic acid.
| Compound Name | [6-[bis(phosphonomethyl)amino]hexyl-[[hydroxy(methyl)phosphoryl]methyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 59414854 |
| Molecular Formula | C11H30N2O11P4 |
| Molecular Weight | 490.26 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | [6-[bis(phosphonomethyl)amino]hexyl-[[hydroxy(methyl)phosphoryl]methyl]amino]methylphosphonic acid |
| SMILES | CP(=O)(O)CN(CCCCCCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C11H30N2O11P4/c1-25(14,15)8-12(9-26(16,17)18)6-4-2-3-5-7-13(10-27(19,20)21)11-28(22,23)24/h2-11H2,1H3,(H,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24) |
| InChIKey | GRWVZBAJQRCUFU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 216.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|