C7H20N2O8P2 — CID 20776520
[3-(dimethylamino)propyl-(phosphonooxymethyl)amino]methyl dihydrogen phosphate (PubChem CID 20776520) has the molecular formula C7H20N2O8P2 and a molecular weight of 322.19 g/mol. Its IUPAC name is [3-(dimethylamino)propyl-(phosphonooxymethyl)amino]methyl dihydrogen phosphate.
| Compound Name | [3-(dimethylamino)propyl-(phosphonooxymethyl)amino]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 20776520 |
| Molecular Formula | C7H20N2O8P2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [3-(dimethylamino)propyl-(phosphonooxymethyl)amino]methyl dihydrogen phosphate |
| SMILES | CN(C)CCCN(COP(=O)(O)O)COP(=O)(O)O |
| InChI | InChI=1S/C7H20N2O8P2/c1-8(2)4-3-5-9(6-16-18(10,11)12)7-17-19(13,14)15/h3-7H2,1-2H3,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | VQQDTJKPVNECOB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|