C4H12N2O9P2 — CID 20776540
[(2-amino-2-oxoethyl)-(phosphonooxymethyl)amino]methyl dihydrogen phosphate (PubChem CID 20776540) has the molecular formula C4H12N2O9P2 and a molecular weight of 294.09 g/mol. Its IUPAC name is [(2-amino-2-oxoethyl)-(phosphonooxymethyl)amino]methyl dihydrogen phosphate.
| Compound Name | [(2-amino-2-oxoethyl)-(phosphonooxymethyl)amino]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 20776540 |
| Molecular Formula | C4H12N2O9P2 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | [(2-amino-2-oxoethyl)-(phosphonooxymethyl)amino]methyl dihydrogen phosphate |
| SMILES | NC(=O)CN(COP(=O)(O)O)COP(=O)(O)O |
| InChI | InChI=1S/C4H12N2O9P2/c5-4(7)1-6(2-14-16(8,9)10)3-15-17(11,12)13/h1-3H2,(H2,5,7)(H2,8,9,10)(H2,11,12,13) |
| InChIKey | HQIZHQMYEQZVQA-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 179.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|