C14H28N8O5 — CID 10134862
2-[bis[2-[bis(2-amino-2-oxoethyl)amino]ethyl]amino]acetamide (PubChem CID 10134862) has the molecular formula C14H28N8O5 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[bis[2-[bis(2-amino-2-oxoethyl)amino]ethyl]amino]acetamide.
| Compound Name | 2-[bis[2-[bis(2-amino-2-oxoethyl)amino]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 10134862 |
| Molecular Formula | C14H28N8O5 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[bis[2-[bis(2-amino-2-oxoethyl)amino]ethyl]amino]acetamide |
| SMILES | NC(=O)CN(CCN(CC(N)=O)CC(N)=O)CCN(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C14H28N8O5/c15-10(23)5-20(1-3-21(6-11(16)24)7-12(17)25)2-4-22(8-13(18)26)9-14(19)27/h1-9H2,(H2,15,23)(H2,16,24)(H2,17,25)(H2,18,26)(H2,19,27) |
| InChIKey | RAEIIDYNDAXHDS-UHFFFAOYSA-N |
| XLogP | -5.68 |
| TPSA | 225.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |