C7H15N3O3 — CID 107440465
2-[(2-amino-2-oxoethyl)-(3-aminopropyl)amino]acetic acid (PubChem CID 107440465) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(3-aminopropyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(3-aminopropyl)amino]acetic acid |
|---|---|
| PubChem CID | 107440465 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(3-aminopropyl)amino]acetic acid |
| SMILES | NCCCN(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C7H15N3O3/c8-2-1-3-10(4-6(9)11)5-7(12)13/h1-5,8H2,(H2,9,11)(H,12,13) |
| InChIKey | YPAJGINMBRGZSR-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |