C10H16K4N2O8 — CID 131881711
CID 131881711 (PubChem CID 131881711) has the molecular formula C10H16K4N2O8 and a molecular weight of 448.64 g/mol.
| Compound Name | CID 131881711 |
|---|---|
| PubChem CID | 131881711 |
| Molecular Formula | C10H16K4N2O8 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 447.95 |
| IUPAC Name | — |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[K].[K].[K].[K] |
| InChI | InChI=1S/C10H16N2O8.4K/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;; |
| InChIKey | ONATYSLUCORNRQ-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |