C10H16N2O8Y+3 — CID 23618997
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;yttrium(3+) (PubChem CID 23618997) has the molecular formula C10H16N2O8Y+3 and a molecular weight of 381.15 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;yttrium(3+).
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;yttrium(3+) |
|---|---|
| PubChem CID | 23618997 |
| Molecular Formula | C10H16N2O8Y+3 |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;yttrium(3+) |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Y+3] |
| InChI | InChI=1S/C10H16N2O8.Y/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/q;+3 |
| InChIKey | PPPFOSNIFADAMA-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |