C10H18LiN2O9+ — CID 56942126
lithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrate (PubChem CID 56942126) has the molecular formula C10H18LiN2O9+ and a molecular weight of 317.20 g/mol. Its IUPAC name is lithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrate.
| Compound Name | lithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrate |
|---|---|
| PubChem CID | 56942126 |
| Molecular Formula | C10H18LiN2O9+ |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | lithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrate |
| SMILES | O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Li+] |
| InChI | InChI=1S/C10H16N2O8.Li.H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;1H2/q;+1; |
| InChIKey | ZVABHCHYEMFRSK-UHFFFAOYSA-N |
| XLogP | -5.89 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |